C31H36O7 — CID 11060387
(1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)-4-prop-2-enoxycyclohexane-1,2-diol (PubChem CID 11060387) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)-4-prop-2-enoxycyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)-4-prop-2-enoxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11060387 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)-4-prop-2-enoxycyclohexane-1,2-diol |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C(O)[C@@H](O)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H36O7/c1-3-18-35-30-28(37-21-24-14-16-25(34-2)17-15-24)26(32)27(33)29(36-19-22-10-6-4-7-11-22)31(30)38-20-23-12-8-5-9-13-23/h3-17,26-33H,1,18-21H2,2H3/t26-,27?,28-,29-,30+,31+/m1/s1 |
| InChIKey | QAVLDZXIVZZZSL-INECISDDSA-N |
| XLogP | 4.06 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|