C23H32O7 — CID 11877256
(3aR,4S,5S,6S,7S,7aR)-4-[(4-methoxyphenyl)methoxy]-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol (PubChem CID 11877256) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is (3aR,4S,5S,6S,7S,7aR)-4-[(4-methoxyphenyl)methoxy]-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol.
| Compound Name | (3aR,4S,5S,6S,7S,7aR)-4-[(4-methoxyphenyl)methoxy]-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol |
|---|---|
| PubChem CID | 11877256 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (3aR,4S,5S,6S,7S,7aR)-4-[(4-methoxyphenyl)methoxy]-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@H](O)[C@H](OCc2ccc(OC)cc2)[C@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C23H32O7/c1-3-13-27-19-17(24)18(25)20(28-14-15-7-9-16(26-2)10-8-15)22-21(19)29-23(30-22)11-5-4-6-12-23/h3,7-10,17-22,24-25H,1,4-6,11-14H2,2H3/t17-,18-,19-,20-,21+,22+/m0/s1 |
| InChIKey | ZHUWNCGRUWFHCZ-PCPGVINSSA-N |
| XLogP | 2.33 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|