C25H34O6 — CID 14077537
(3aR,4S,5S,6R,7S,7aS)-6-phenylmethoxy-4,7-bis(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol (PubChem CID 14077537) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (3aR,4S,5S,6R,7S,7aS)-6-phenylmethoxy-4,7-bis(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol.
| Compound Name | (3aR,4S,5S,6R,7S,7aS)-6-phenylmethoxy-4,7-bis(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol |
|---|---|
| PubChem CID | 14077537 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3aR,4S,5S,6R,7S,7aS)-6-phenylmethoxy-4,7-bis(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol |
| SMILES | C=CCO[C@@H]1[C@@H]2OC3(CCCCC3)O[C@@H]2[C@@H](OCC=C)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H34O6/c1-3-15-27-21-19(26)20(29-17-18-11-7-5-8-12-18)22(28-16-4-2)24-23(21)30-25(31-24)13-9-6-10-14-25/h3-5,7-8,11-12,19-24,26H,1-2,6,9-10,13-17H2/t19-,20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | XFVXIHZANYXTMV-VXAMWORUSA-N |
| XLogP | 3.53 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|