C29H40O7 — CID 10553454
(3aS,4S,5R,6S,7S,7aR)-5-[(4-methoxyphenyl)methoxy]-4,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 10553454) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is (3aS,4S,5R,6S,7S,7aR)-5-[(4-methoxyphenyl)methoxy]-4,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane].
| Compound Name | (3aS,4S,5R,6S,7S,7aR)-5-[(4-methoxyphenyl)methoxy]-4,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 10553454 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | (3aS,4S,5R,6S,7S,7aR)-5-[(4-methoxyphenyl)methoxy]-4,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccc(OC)cc2)[C@H](OCC=C)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OCC=C |
| InChI | InChI=1S/C29H40O7/c1-5-17-31-23-24(34-20-21-11-13-22(30-4)14-12-21)26(33-19-7-3)28-27(25(23)32-18-6-2)35-29(36-28)15-9-8-10-16-29/h5-7,11-14,23-28H,1-3,8-10,15-20H2,4H3/t23-,24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | XFTXBJKMZYNEKM-NUFRCSJQSA-N |
| XLogP | 4.75 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|