C41H46O7 — CID 10604284
1-methoxy-4-[[(1R,2R,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexyl]oxymethyl]benzene (PubChem CID 10604284) has the molecular formula C41H46O7 and a molecular weight of 650.81 g/mol. Its IUPAC name is 1-methoxy-4-[[(1R,2R,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexyl]oxymethyl]benzene.
| Compound Name | 1-methoxy-4-[[(1R,2R,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexyl]oxymethyl]benzene |
|---|---|
| PubChem CID | 10604284 |
| Molecular Formula | C41H46O7 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 1-methoxy-4-[[(1R,2R,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexyl]oxymethyl]benzene |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccc(OC)cc2)[C@H](OCc2ccccc2)[C@@H](OCC=C)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O7/c1-4-25-43-36-38(45-27-31-15-9-6-10-16-31)39(46-28-32-17-11-7-12-18-32)37(44-26-5-2)41(40(36)47-29-33-19-13-8-14-20-33)48-30-34-21-23-35(42-3)24-22-34/h4-24,36-41H,1-2,25-30H2,3H3/t36-,37-,38-,39+,40+,41+/m0/s1 |
| InChIKey | SYMSOIVQKDRPAF-PDTDBKHHSA-N |
| XLogP | 7.49 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|