C36H38O7 — CID 10579163
(1S,2R,3S,4S,5R)-2,3-bis[(4-methoxyphenyl)methoxy]-4,5-bis(phenylmethoxy)cyclopentane-1-carbaldehyde (PubChem CID 10579163) has the molecular formula C36H38O7 and a molecular weight of 582.69 g/mol. Its IUPAC name is (1S,2R,3S,4S,5R)-2,3-bis[(4-methoxyphenyl)methoxy]-4,5-bis(phenylmethoxy)cyclopentane-1-carbaldehyde.
| Compound Name | (1S,2R,3S,4S,5R)-2,3-bis[(4-methoxyphenyl)methoxy]-4,5-bis(phenylmethoxy)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 10579163 |
| Molecular Formula | C36H38O7 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | (1S,2R,3S,4S,5R)-2,3-bis[(4-methoxyphenyl)methoxy]-4,5-bis(phenylmethoxy)cyclopentane-1-carbaldehyde |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](C=O)[C@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H38O7/c1-38-30-17-13-28(14-18-30)24-41-34-32(21-37)33(40-22-26-9-5-3-6-10-26)35(42-23-27-11-7-4-8-12-27)36(34)43-25-29-15-19-31(39-2)20-16-29/h3-21,32-36H,22-25H2,1-2H3/t32-,33+,34+,35-,36-/m0/s1 |
| InChIKey | HIFSMFXAVHKQDU-PYHSBISQSA-N |
| XLogP | 6.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|