C35H36O7 — CID 10555028
(2S,3R,4R,5R,6R)-2-(4-methoxyphenoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-4-carbaldehyde (PubChem CID 10555028) has the molecular formula C35H36O7 and a molecular weight of 568.67 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-(4-methoxyphenoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-4-carbaldehyde.
| Compound Name | (2S,3R,4R,5R,6R)-2-(4-methoxyphenoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-4-carbaldehyde |
|---|---|
| PubChem CID | 10555028 |
| Molecular Formula | C35H36O7 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-(4-methoxyphenoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-4-carbaldehyde |
| SMILES | COc1ccc(O[C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](C=O)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H36O7/c1-37-29-17-19-30(20-18-29)41-35-34(40-24-28-15-9-4-10-16-28)31(21-36)33(39-23-27-13-7-3-8-14-27)32(42-35)25-38-22-26-11-5-2-6-12-26/h2-21,31-35H,22-25H2,1H3/t31-,32-,33-,34-,35-/m1/s1 |
| InChIKey | FNBGAXGQTAFVQY-ZQPTVKGJSA-N |
| XLogP | 6.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|