C40H40O7 — CID 134277169
4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol (PubChem CID 134277169) has the molecular formula C40H40O7 and a molecular weight of 632.75 g/mol. Its IUPAC name is 4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol.
| Compound Name | 4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol |
|---|---|
| PubChem CID | 134277169 |
| Molecular Formula | C40H40O7 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol |
| SMILES | Oc1ccc(OC2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40O7/c41-34-21-23-35(24-22-34)46-40-39(45-28-33-19-11-4-12-20-33)38(44-27-32-17-9-3-10-18-32)37(43-26-31-15-7-2-8-16-31)36(47-40)29-42-25-30-13-5-1-6-14-30/h1-24,36-41H,25-29H2/t36-,37-,38+,39-,40?/m1/s1 |
| InChIKey | SWGRZGXCPLZRSF-CAIHAHRASA-N |
| XLogP | 7.47 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |