C42H42O8 — CID 46839327
[3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] acetate (PubChem CID 46839327) has the molecular formula C42H42O8 and a molecular weight of 674.79 g/mol. Its IUPAC name is [3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] acetate.
| Compound Name | [3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] acetate |
|---|---|
| PubChem CID | 46839327 |
| Molecular Formula | C42H42O8 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | [3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(O[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)c1 |
| InChI | InChI=1S/C42H42O8/c1-31(43)48-36-23-14-24-37(25-36)49-42-41(47-29-35-21-12-5-13-22-35)40(46-28-34-19-10-4-11-20-34)39(45-27-33-17-8-3-9-18-33)38(50-42)30-44-26-32-15-6-2-7-16-32/h2-25,38-42H,26-30H2,1H3/t38-,39-,40+,41+,42+/m1/s1 |
| InChIKey | MXHNPDKUEJFUBK-LPAYBXTFSA-N |
| XLogP | 7.69 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|