C52H48O11 — CID 54187268
[2-oxo-3-phenylmethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxychromen-7-yl] acetate (PubChem CID 54187268) has the molecular formula C52H48O11 and a molecular weight of 848.95 g/mol. Its IUPAC name is [2-oxo-3-phenylmethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxychromen-7-yl] acetate.
| Compound Name | [2-oxo-3-phenylmethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxychromen-7-yl] acetate |
|---|---|
| PubChem CID | 54187268 |
| Molecular Formula | C52H48O11 |
| Molecular Weight | 848.95 g/mol |
| Exact Mass | 848.32 |
| IUPAC Name | [2-oxo-3-phenylmethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxychromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(O[C@@H]3O[C@H](COCc4ccccc4)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c(OCc3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C52H48O11/c1-36(53)60-42-27-28-43-44(29-42)61-51(54)49(58-33-40-23-13-5-14-24-40)46(43)63-52-50(59-34-41-25-15-6-16-26-41)48(57-32-39-21-11-4-12-22-39)47(56-31-38-19-9-3-10-20-38)45(62-52)35-55-30-37-17-7-2-8-18-37/h2-29,45,47-48,50,52H,30-35H2,1H3/t45-,47+,48+,50-,52+/m1/s1 |
| InChIKey | PFYFTSMKYPXAHQ-ONRWWLHCSA-N |
| XLogP | 9.37 |
| TPSA | 121.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.95 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|