C56H57O10P — CID 11216804
dibenzyl [(1S,2S,3R,4R,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] phosphate (PubChem CID 11216804) has the molecular formula C56H57O10P and a molecular weight of 921.04 g/mol. Its IUPAC name is dibenzyl [(1S,2S,3R,4R,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] phosphate.
| Compound Name | dibenzyl [(1S,2S,3R,4R,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] phosphate |
|---|---|
| PubChem CID | 11216804 |
| Molecular Formula | C56H57O10P |
| Molecular Weight | 921.04 g/mol |
| Exact Mass | 920.37 |
| IUPAC Name | dibenzyl [(1S,2S,3R,4R,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] phosphate |
| SMILES | COc1ccc(COC2[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OP(=O)(OCc3ccccc3)OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C56H57O10P/c1-58-50-34-32-49(33-35-50)40-61-53-51(59-36-43-20-8-2-9-21-43)52(60-37-44-22-10-3-11-23-44)54(62-38-45-24-12-4-13-25-45)56(55(53)63-39-46-26-14-5-15-27-46)66-67(57,64-41-47-28-16-6-17-29-47)65-42-48-30-18-7-19-31-48/h2-35,51-56H,36-42H2,1H3/t51-,52+,53?,54-,55+,56+/m1/s1 |
| InChIKey | CTKXRSJEUBKSNA-IJJFXPRDSA-N |
| XLogP | 11.86 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.04 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|