C55H56O12P2 — CID 16744353
dibenzyl [(1R,2R,3S,4R,5R,6R)-3-bis(phenylmethoxy)phosphoryloxy-4-hydroxy-2,5,6-tris(phenylmethoxy)cyclohexyl] phosphate (PubChem CID 16744353) has the molecular formula C55H56O12P2 and a molecular weight of 970.99 g/mol. Its IUPAC name is dibenzyl [(1R,2R,3S,4R,5R,6R)-3-bis(phenylmethoxy)phosphoryloxy-4-hydroxy-2,5,6-tris(phenylmethoxy)cyclohexyl] phosphate.
| Compound Name | dibenzyl [(1R,2R,3S,4R,5R,6R)-3-bis(phenylmethoxy)phosphoryloxy-4-hydroxy-2,5,6-tris(phenylmethoxy)cyclohexyl] phosphate |
|---|---|
| PubChem CID | 16744353 |
| Molecular Formula | C55H56O12P2 |
| Molecular Weight | 970.99 g/mol |
| Exact Mass | 970.32 |
| IUPAC Name | dibenzyl [(1R,2R,3S,4R,5R,6R)-3-bis(phenylmethoxy)phosphoryloxy-4-hydroxy-2,5,6-tris(phenylmethoxy)cyclohexyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)O[C@@H]1[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](O)[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C55H56O12P2/c56-50-51(59-36-43-22-8-1-9-23-43)53(60-37-44-24-10-2-11-25-44)55(67-69(58,64-41-48-32-18-6-19-33-48)65-42-49-34-20-7-21-35-49)54(61-38-45-26-12-3-13-27-45)52(50)66-68(57,62-39-46-28-14-4-15-29-46)63-40-47-30-16-5-17-31-47/h1-35,50-56H,36-42H2/t50-,51-,52+,53-,54-,55-/m1/s1 |
| InChIKey | JNHCUYBDYYENRD-GCZOZYPFSA-N |
| XLogP | 11.97 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.99 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|