C41H52O11P2 — CID 122389774
(1R,2S,3R,4R,5S,6S)-3-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]oxy-2,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 122389774) has the molecular formula C41H52O11P2 and a molecular weight of 782.80 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S,6S)-3-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]oxy-2,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2S,3R,4R,5S,6S)-3-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]oxy-2,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 122389774 |
| Molecular Formula | C41H52O11P2 |
| Molecular Weight | 782.80 g/mol |
| Exact Mass | 782.30 |
| IUPAC Name | (1R,2S,3R,4R,5S,6S)-3-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]oxy-2,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CCOP(=O)(CP(=O)(OCC)O[C@@H]1[C@@H](OCc2ccccc2)[C@H](O)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1)OCC |
| InChI | InChI=1S/C41H52O11P2/c1-4-49-53(43,50-5-2)31-54(44,51-6-3)52-41-38(46-28-33-21-13-8-14-22-33)36(42)37(45-27-32-19-11-7-12-20-32)39(47-29-34-23-15-9-16-24-34)40(41)48-30-35-25-17-10-18-26-35/h7-26,36-42H,4-6,27-31H2,1-3H3/t36-,37+,38+,39?,40-,41-,54?/m1/s1 |
| InChIKey | YRWYLOPERAIGEI-RHCYEWPZSA-N |
| XLogP | 8.54 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.80 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|