C39H39O9P — CID 11422539
[(2R,3S,5R,6R)-3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexyl] diphenyl phosphate (PubChem CID 11422539) has the molecular formula C39H39O9P and a molecular weight of 682.71 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexyl] diphenyl phosphate.
| Compound Name | [(2R,3S,5R,6R)-3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexyl] diphenyl phosphate |
|---|---|
| PubChem CID | 11422539 |
| Molecular Formula | C39H39O9P |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | [(2R,3S,5R,6R)-3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexyl] diphenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)OC1[C@H](OCc2ccccc2)C(O)C(OCc2ccccc2)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H39O9P/c40-34-36(43-26-29-16-6-1-7-17-29)35(41)38(45-28-31-20-10-3-11-21-31)39(37(34)44-27-30-18-8-2-9-19-30)48-49(42,46-32-22-12-4-13-23-32)47-33-24-14-5-15-25-33/h1-25,34-41H,26-28H2/t34-,35?,36?,37+,38+,39?/m0/s1 |
| InChIKey | BYMRGMPKVJMPKI-VIMCZXLJSA-N |
| XLogP | 7.13 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|