C64H67O17P3 — CID 10418838
dibenzyl [(1R,3S,4S,6S)-2,3-bis[bis(phenylmethoxy)phosphoryloxy]-5-hydroxy-4,6-bis(phenylmethoxymethoxy)cyclohexyl] phosphate (PubChem CID 10418838) has the molecular formula C64H67O17P3 and a molecular weight of 1201.14 g/mol. Its IUPAC name is dibenzyl [(1R,3S,4S,6S)-2,3-bis[bis(phenylmethoxy)phosphoryloxy]-5-hydroxy-4,6-bis(phenylmethoxymethoxy)cyclohexyl] phosphate.
| Compound Name | dibenzyl [(1R,3S,4S,6S)-2,3-bis[bis(phenylmethoxy)phosphoryloxy]-5-hydroxy-4,6-bis(phenylmethoxymethoxy)cyclohexyl] phosphate |
|---|---|
| PubChem CID | 10418838 |
| Molecular Formula | C64H67O17P3 |
| Molecular Weight | 1201.14 g/mol |
| Exact Mass | 1200.36 |
| IUPAC Name | dibenzyl [(1R,3S,4S,6S)-2,3-bis[bis(phenylmethoxy)phosphoryloxy]-5-hydroxy-4,6-bis(phenylmethoxymethoxy)cyclohexyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)OC1[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H](OCOCc2ccccc2)C(O)[C@H](OCOCc2ccccc2)[C@H]1OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C64H67O17P3/c65-59-60(71-49-69-41-51-25-9-1-10-26-51)62(79-82(66,73-43-53-29-13-3-14-30-53)74-44-54-31-15-4-16-32-54)64(81-84(68,77-47-57-37-21-7-22-38-57)78-48-58-39-23-8-24-40-58)63(61(59)72-50-70-42-52-27-11-2-12-28-52)80-83(67,75-45-55-33-17-5-18-34-55)76-46-56-35-19-6-20-36-56/h1-40,59-65H,41-50H2/t59?,60-,61-,62-,63+,64?/m0/s1 |
| InChIKey | BKDNKXPLFYJCLZ-SYGMABDASA-N |
| XLogP | 14.26 |
| TPSA | 191.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.14 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|