C24H29O4P — CID 102280168
2-adamantyl dibenzyl phosphate (PubChem CID 102280168) has the molecular formula C24H29O4P and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-adamantyl dibenzyl phosphate.
| Compound Name | 2-adamantyl dibenzyl phosphate |
|---|---|
| PubChem CID | 102280168 |
| Molecular Formula | C24H29O4P |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-adamantyl dibenzyl phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C24H29O4P/c25-29(26-16-18-7-3-1-4-8-18,27-17-19-9-5-2-6-10-19)28-24-22-12-20-11-21(14-22)15-23(24)13-20/h1-10,20-24H,11-17H2 |
| InChIKey | BGZCMDIZMYQABM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|