C37H43O7P — CID 15265960
dibenzyl [(1S,2R,4S,6R)-2,4-bis(phenylmethoxy)-6-propoxycyclohexyl] phosphate (PubChem CID 15265960) has the molecular formula C37H43O7P and a molecular weight of 630.72 g/mol. Its IUPAC name is dibenzyl [(1S,2R,4S,6R)-2,4-bis(phenylmethoxy)-6-propoxycyclohexyl] phosphate.
| Compound Name | dibenzyl [(1S,2R,4S,6R)-2,4-bis(phenylmethoxy)-6-propoxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 15265960 |
| Molecular Formula | C37H43O7P |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | dibenzyl [(1S,2R,4S,6R)-2,4-bis(phenylmethoxy)-6-propoxycyclohexyl] phosphate |
| SMILES | CCCO[C@@H]1C[C@H](OCc2ccccc2)C[C@@H](OCc2ccccc2)[C@H]1OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H43O7P/c1-2-23-39-35-24-34(40-26-30-15-7-3-8-16-30)25-36(41-27-31-17-9-4-10-18-31)37(35)44-45(38,42-28-32-19-11-5-12-20-32)43-29-33-21-13-6-14-22-33/h3-22,34-37H,2,23-29H2,1H3/t34-,35+,36+,37-/m0/s1 |
| InChIKey | SQSCKUKTIDKNDP-YUYNGSOASA-N |
| XLogP | 8.67 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|