C19H22O3 — CID 57200651
2,4-bis(phenylmethoxy)cyclopentan-1-ol (PubChem CID 57200651) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,4-bis(phenylmethoxy)cyclopentan-1-ol.
| Compound Name | 2,4-bis(phenylmethoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 57200651 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2,4-bis(phenylmethoxy)cyclopentan-1-ol |
| SMILES | OC1CC(OCc2ccccc2)CC1OCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c20-18-11-17(21-13-15-7-3-1-4-8-15)12-19(18)22-14-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2 |
| InChIKey | BVQKITGRYWZFRZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |