C14H20O3 — CID 14666183
(1R,2R,5R)-2-methoxy-5-phenylmethoxycyclohexan-1-ol (PubChem CID 14666183) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,2R,5R)-2-methoxy-5-phenylmethoxycyclohexan-1-ol.
| Compound Name | (1R,2R,5R)-2-methoxy-5-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 14666183 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,2R,5R)-2-methoxy-5-phenylmethoxycyclohexan-1-ol |
| SMILES | CO[C@@H]1CC[C@@H](OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C14H20O3/c1-16-14-8-7-12(9-13(14)15)17-10-11-5-3-2-4-6-11/h2-6,12-15H,7-10H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | ANTCDWLBQGJIBH-MGPQQGTHSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |