C20H24O4 — CID 91005929
(1R,3S,5S)-3,5-bis(phenylmethoxy)cyclohexane-1,2-diol (PubChem CID 91005929) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,3S,5S)-3,5-bis(phenylmethoxy)cyclohexane-1,2-diol.
| Compound Name | (1R,3S,5S)-3,5-bis(phenylmethoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 91005929 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1R,3S,5S)-3,5-bis(phenylmethoxy)cyclohexane-1,2-diol |
| SMILES | OC1[C@H](O)C[C@H](OCc2ccccc2)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H24O4/c21-18-11-17(23-13-15-7-3-1-4-8-15)12-19(20(18)22)24-14-16-9-5-2-6-10-16/h1-10,17-22H,11-14H2/t17-,18+,19-,20?/m0/s1 |
| InChIKey | NPGZLRFNNBUOHS-COHPWVSRSA-N |
| XLogP | 2.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |