C20H24O6S — CID 15428198
[(1R,2R,3R,5R)-2,3-dihydroxy-5-phenylmethoxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 15428198) has the molecular formula C20H24O6S and a molecular weight of 392.47 g/mol. Its IUPAC name is [(1R,2R,3R,5R)-2,3-dihydroxy-5-phenylmethoxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3R,5R)-2,3-dihydroxy-5-phenylmethoxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15428198 |
| Molecular Formula | C20H24O6S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(1R,2R,3R,5R)-2,3-dihydroxy-5-phenylmethoxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@H](OCc3ccccc3)C[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H24O6S/c1-14-7-9-17(10-8-14)27(23,24)26-19-12-16(11-18(21)20(19)22)25-13-15-5-3-2-4-6-15/h2-10,16,18-22H,11-13H2,1H3/t16-,18-,19-,20-/m1/s1 |
| InChIKey | RRYXZNZNPWCBMP-VBSBHUPXSA-N |
| XLogP | 2.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|