C26H28O7S — CID 171123994
[(2S,3R,4R,5R)-2-hydroxy-4,5-bis(phenylmethoxy)oxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 171123994) has the molecular formula C26H28O7S and a molecular weight of 484.57 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-hydroxy-4,5-bis(phenylmethoxy)oxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4R,5R)-2-hydroxy-4,5-bis(phenylmethoxy)oxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171123994 |
| Molecular Formula | C26H28O7S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [(2S,3R,4R,5R)-2-hydroxy-4,5-bis(phenylmethoxy)oxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](OCc3ccccc3)C(OCc3ccccc3)CO[C@@H]2O)cc1 |
| InChI | InChI=1S/C26H28O7S/c1-19-12-14-22(15-13-19)34(28,29)33-25-24(31-17-21-10-6-3-7-11-21)23(18-32-26(25)27)30-16-20-8-4-2-5-9-20/h2-15,23-27H,16-18H2,1H3/t23?,24-,25-,26+/m1/s1 |
| InChIKey | IQLCZDTVZMOUIL-RPQAKUOQSA-N |
| XLogP | 3.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|