C20H22O6S — CID 88902214
[(3S,6R)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate (PubChem CID 88902214) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is [(3S,6R)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,6R)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88902214 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [(3S,6R)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2COC3C2OC[C@@H]3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O6S/c1-14-7-9-16(10-8-14)27(21,22)26-18-13-25-19-17(12-24-20(18)19)23-11-15-5-3-2-4-6-15/h2-10,17-20H,11-13H2,1H3/t17-,18+,19?,20?/m0/s1 |
| InChIKey | RJLKAMSBQKEZDL-WBYGSUFKSA-N |
| XLogP | 2.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|