C41H40O8S — CID 10723334
[(1R,3S,4R,5R,6S)-2-oxo-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] 4-methylbenzenesulfonate (PubChem CID 10723334) has the molecular formula C41H40O8S and a molecular weight of 692.83 g/mol. Its IUPAC name is [(1R,3S,4R,5R,6S)-2-oxo-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,3S,4R,5R,6S)-2-oxo-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10723334 |
| Molecular Formula | C41H40O8S |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | [(1R,3S,4R,5R,6S)-2-oxo-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C(=O)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H40O8S/c1-30-22-24-35(25-23-30)50(43,44)49-38-36(42)37(45-26-31-14-6-2-7-15-31)39(46-27-32-16-8-3-9-17-32)41(48-29-34-20-12-5-13-21-34)40(38)47-28-33-18-10-4-11-19-33/h2-25,37-41H,26-29H2,1H3/t37-,38+,39+,40-,41-/m1/s1 |
| InChIKey | JHOXYTDNKVLSJM-WQLDJJBGSA-N |
| XLogP | 6.99 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|