C36H38O7S — CID 11801923
[(2R,3R,4R,5S,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11801923) has the molecular formula C36H38O7S and a molecular weight of 614.76 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11801923 |
| Molecular Formula | C36H38O7S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=C[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O7S/c1-3-32-34(39-23-28-13-7-4-8-14-28)36(41-25-30-17-11-6-12-18-30)35(40-24-29-15-9-5-10-16-29)33(43-32)26-42-44(37,38)31-21-19-27(2)20-22-31/h3-22,32-36H,1,23-26H2,2H3/t32-,33+,34-,35+,36+/m0/s1 |
| InChIKey | GJXRXLIZBFEXJV-LPMXJBPNSA-N |
| XLogP | 6.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|