C41H45NO11S — CID 87402049
[(2R,3R,4S,5R,6R)-2-[(4-methylphenyl)sulfonyloxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxan-3-yl] 3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 87402049) has the molecular formula C41H45NO11S and a molecular weight of 759.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[(4-methylphenyl)sulfonyloxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxan-3-yl] 3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[(4-methylphenyl)sulfonyloxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxan-3-yl] 3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 87402049 |
| Molecular Formula | C41H45NO11S |
| Molecular Weight | 759.87 g/mol |
| Exact Mass | 759.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[(4-methylphenyl)sulfonyloxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxan-3-yl] 3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C=CCO[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(=O)CCNC(=O)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H45NO11S/c1-3-25-47-40-39(49-27-32-15-9-5-10-16-32)38(48-26-31-13-7-4-8-14-31)37(35(52-40)29-51-54(45,46)34-21-19-30(2)20-22-34)53-36(43)23-24-42-41(44)50-28-33-17-11-6-12-18-33/h3-22,35,37-40H,1,23-29H2,2H3,(H,42,44)/t35-,37-,38+,39-,40-/m1/s1 |
| InChIKey | YKEFKUXDEYTNIC-HRSAFRLBSA-N |
| XLogP | 6.03 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.87 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|