C29H39NO7S — CID 135023005
[(2S,3S,5Z,8S,9S)-3-[2-(dimethylamino)-2-oxoethoxy]-9-ethyl-8-phenylmethoxy-2,3,4,7,8,9-hexahydrooxonin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 135023005) has the molecular formula C29H39NO7S and a molecular weight of 545.70 g/mol. Its IUPAC name is [(2S,3S,5Z,8S,9S)-3-[2-(dimethylamino)-2-oxoethoxy]-9-ethyl-8-phenylmethoxy-2,3,4,7,8,9-hexahydrooxonin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,5Z,8S,9S)-3-[2-(dimethylamino)-2-oxoethoxy]-9-ethyl-8-phenylmethoxy-2,3,4,7,8,9-hexahydrooxonin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135023005 |
| Molecular Formula | C29H39NO7S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [(2S,3S,5Z,8S,9S)-3-[2-(dimethylamino)-2-oxoethoxy]-9-ethyl-8-phenylmethoxy-2,3,4,7,8,9-hexahydrooxonin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC[C@@H]1O[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OCC(=O)N(C)C)C/C=C\C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H39NO7S/c1-5-25-26(34-19-23-11-7-6-8-12-23)13-9-10-14-27(35-21-29(31)30(3)4)28(37-25)20-36-38(32,33)24-17-15-22(2)16-18-24/h6-12,15-18,25-28H,5,13-14,19-21H2,1-4H3/b10-9-/t25-,26-,27-,28-/m0/s1 |
| InChIKey | JZOBEPLSXQPYNL-ZHUJRDODSA-N |
| XLogP | 4.27 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|