C30H34O9S — CID 102328750
[(2R,3R,4S,5S,6S)-6-methoxy-4-(4-methylphenyl)sulfonyloxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 102328750) has the molecular formula C30H34O9S and a molecular weight of 570.66 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-6-methoxy-4-(4-methylphenyl)sulfonyloxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-6-methoxy-4-(4-methylphenyl)sulfonyloxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102328750 |
| Molecular Formula | C30H34O9S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-6-methoxy-4-(4-methylphenyl)sulfonyloxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O9S/c1-21-14-16-25(17-15-21)40(32,33)39-28-27(36-18-23-10-6-4-7-11-23)26(20-35-22(2)31)38-30(34-3)29(28)37-19-24-12-8-5-9-13-24/h4-17,26-30H,18-20H2,1-3H3/t26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | HVQDGPKPDFZNRJ-ZNOUKXQUSA-N |
| XLogP | 4.17 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|