C23H28O8S — CID 14052139
[(2R,3S,4R,5R,6S)-2-methoxy-6-methyl-4-(4-methylphenyl)sulfonyloxy-5-phenylmethoxyoxan-3-yl] acetate (PubChem CID 14052139) has the molecular formula C23H28O8S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2-methoxy-6-methyl-4-(4-methylphenyl)sulfonyloxy-5-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-2-methoxy-6-methyl-4-(4-methylphenyl)sulfonyloxy-5-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 14052139 |
| Molecular Formula | C23H28O8S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2-methoxy-6-methyl-4-(4-methylphenyl)sulfonyloxy-5-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](OCc2ccccc2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O8S/c1-15-10-12-19(13-11-15)32(25,26)31-21-20(28-14-18-8-6-5-7-9-18)16(2)29-23(27-4)22(21)30-17(3)24/h5-13,16,20-23H,14H2,1-4H3/t16-,20+,21+,22-,23+/m0/s1 |
| InChIKey | AALBKRUVQZFVBV-QANUBGTFSA-N |
| XLogP | 2.98 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|