C27H30O8S2 — CID 101187715
[(2R,3R,4R,6S)-2-methyl-3-(4-methylphenyl)sulfonyloxy-6-phenylmethoxyoxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 101187715) has the molecular formula C27H30O8S2 and a molecular weight of 546.66 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-2-methyl-3-(4-methylphenyl)sulfonyloxy-6-phenylmethoxyoxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,6S)-2-methyl-3-(4-methylphenyl)sulfonyloxy-6-phenylmethoxyoxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101187715 |
| Molecular Formula | C27H30O8S2 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [(2R,3R,4R,6S)-2-methyl-3-(4-methylphenyl)sulfonyloxy-6-phenylmethoxyoxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@@H](C)O[C@H](OCc3ccccc3)C[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H30O8S2/c1-19-9-13-23(14-10-19)36(28,29)34-25-17-26(32-18-22-7-5-4-6-8-22)33-21(3)27(25)35-37(30,31)24-15-11-20(2)12-16-24/h4-16,21,25-27H,17-18H2,1-3H3/t21-,25-,26+,27-/m1/s1 |
| InChIKey | KYNCPYBMAIEBKN-ORZNUPDKSA-N |
| XLogP | 4.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|