C34H40O10S — CID 14483785
[(2R,3R,4R,6R)-6-[(2R,3R,4R,6S)-6-methoxy-2-methyl-3-(4-methylphenyl)sulfonyloxyoxan-4-yl]oxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 14483785) has the molecular formula C34H40O10S and a molecular weight of 640.75 g/mol. Its IUPAC name is [(2R,3R,4R,6R)-6-[(2R,3R,4R,6S)-6-methoxy-2-methyl-3-(4-methylphenyl)sulfonyloxyoxan-4-yl]oxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,6R)-6-[(2R,3R,4R,6S)-6-methoxy-2-methyl-3-(4-methylphenyl)sulfonyloxyoxan-4-yl]oxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 14483785 |
| Molecular Formula | C34H40O10S |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | [(2R,3R,4R,6R)-6-[(2R,3R,4R,6S)-6-methoxy-2-methyl-3-(4-methylphenyl)sulfonyloxyoxan-4-yl]oxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CO[C@@H]1C[C@@H](O[C@@H]2C[C@@H](OCc3ccccc3)[C@H](OC(=O)c3ccccc3)[C@@H](C)O2)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](C)O1 |
| InChI | InChI=1S/C34H40O10S/c1-22-15-17-27(18-16-22)45(36,37)44-33-24(3)40-30(38-4)20-29(33)42-31-19-28(39-21-25-11-7-5-8-12-25)32(23(2)41-31)43-34(35)26-13-9-6-10-14-26/h5-18,23-24,28-33H,19-21H2,1-4H3/t23-,24-,28-,29-,30+,31-,32-,33-/m1/s1 |
| InChIKey | BWCFTFMLTSMAEY-XLFLFYPASA-N |
| XLogP | 5.18 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|