C21H23IO5 — CID 67157471
[(2S,3R,4S)-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 67157471) has the molecular formula C21H23IO5 and a molecular weight of 482.31 g/mol. Its IUPAC name is [(2S,3R,4S)-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S)-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 67157471 |
| Molecular Formula | C21H23IO5 |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | [(2S,3R,4S)-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | COC1C[C@H](OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](CI)O1 |
| InChI | InChI=1S/C21H23IO5/c1-24-19-12-17(25-14-15-8-4-2-5-9-15)20(18(13-22)26-19)27-21(23)16-10-6-3-7-11-16/h2-11,17-20H,12-14H2,1H3/t17-,18+,19?,20+/m0/s1 |
| InChIKey | PNNAAZOQAJCVLQ-JWQSRSOLSA-N |
| XLogP | 3.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|