C36H40O6 — CID 58940191
(2R,3R,4S,5S)-7-methoxy-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane (PubChem CID 58940191) has the molecular formula C36H40O6 and a molecular weight of 568.71 g/mol. Its IUPAC name is (2R,3R,4S,5S)-7-methoxy-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane.
| Compound Name | (2R,3R,4S,5S)-7-methoxy-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane |
|---|---|
| PubChem CID | 58940191 |
| Molecular Formula | C36H40O6 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (2R,3R,4S,5S)-7-methoxy-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane |
| SMILES | COC1C[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C36H40O6/c1-37-34-22-32(39-24-29-16-8-3-9-17-29)35(40-25-30-18-10-4-11-19-30)36(41-26-31-20-12-5-13-21-31)33(42-34)27-38-23-28-14-6-2-7-15-28/h2-21,32-36H,22-27H2,1H3/t32-,33+,34?,35-,36+/m0/s1 |
| InChIKey | KFYQFUMLHCHIBK-OJHLWTCNSA-N |
| XLogP | 6.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |