C33H34O5 — CID 126612116
(4R,6S)-6-phenoxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 126612116) has the molecular formula C33H34O5 and a molecular weight of 510.63 g/mol. Its IUPAC name is (4R,6S)-6-phenoxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | (4R,6S)-6-phenoxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 126612116 |
| Molecular Formula | C33H34O5 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (4R,6S)-6-phenoxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COCC2O[C@@H](Oc3ccccc3)C[C@@H](OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H34O5/c1-5-13-26(14-6-1)22-34-25-31-33(36-24-28-17-9-3-10-18-28)30(35-23-27-15-7-2-8-16-27)21-32(38-31)37-29-19-11-4-12-20-29/h1-20,30-33H,21-25H2/t30-,31?,32-,33?/m1/s1 |
| InChIKey | NAQUOHOLVPZXRA-NCWORNCQSA-N |
| XLogP | 6.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |