C42H40O7 — CID 11614427
7-[(2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 11614427) has the molecular formula C42H40O7 and a molecular weight of 656.78 g/mol. Its IUPAC name is 7-[(2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 7-[(2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 11614427 |
| Molecular Formula | C42H40O7 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | 7-[(2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccccc2)Oc2cc(O[C@@H]3C[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O3)ccc21 |
| InChI | InChI=1S/C42H40O7/c43-36-24-37(33-19-11-4-12-20-33)48-38-23-34(21-22-35(36)38)47-41-25-39(45-27-31-15-7-2-8-16-31)42(46-28-32-17-9-3-10-18-32)40(49-41)29-44-26-30-13-5-1-6-14-30/h1-23,37,39-42H,24-29H2/t37?,39-,40-,41+,42+/m1/s1 |
| InChIKey | PARMHGYJVPXWLD-CEKNCRNJSA-N |
| XLogP | 8.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |