C15H13NO5S — CID 59032849
[(2R)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] sulfamate (PubChem CID 59032849) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is [(2R)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] sulfamate.
| Compound Name | [(2R)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] sulfamate |
|---|---|
| PubChem CID | 59032849 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | [(2R)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc2c(c1)O[C@@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C15H13NO5S/c16-22(18,19)21-11-6-7-12-13(17)9-14(20-15(12)8-11)10-4-2-1-3-5-10/h1-8,14H,9H2,(H2,16,18,19)/t14-/m1/s1 |
| InChIKey | SGAUJQZRQVOWQP-CQSZACIVSA-N |
| XLogP | 1.98 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |