C45H50O10 — CID 101265064
[(2R,3S)-4-[(2R,4S,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101265064) has the molecular formula C45H50O10 and a molecular weight of 750.89 g/mol. Its IUPAC name is [(2R,3S)-4-[(2R,4S,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-4-[(2R,4S,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101265064 |
| Molecular Formula | C45H50O10 |
| Molecular Weight | 750.89 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | [(2R,3S)-4-[(2R,4S,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)C=C(O[C@@H]2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H50O10/c1-45(2,3)44(47)52-31-39-43(51-29-35-22-14-7-15-23-35)37(24-40(46)53-39)54-41-25-36(49-27-33-18-10-5-11-19-33)42(50-28-34-20-12-6-13-21-34)38(55-41)30-48-26-32-16-8-4-9-17-32/h4-24,36,38-39,41-43H,25-31H2,1-3H3/t36-,38-,39+,41-,42+,43+/m0/s1 |
| InChIKey | TUAXBOPLDXSFHO-CYJODADYSA-N |
| XLogP | 7.49 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.89 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |