C26H38O6 — CID 11316787
[(2R,3S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-prop-2-enyloxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11316787) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [(2R,3S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-prop-2-enyloxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-prop-2-enyloxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11316787 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [(2R,3S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-prop-2-enyloxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H38O6/c1-8-12-19-20(29-16-18-13-10-9-11-14-18)15-21(32-24(28)26(5,6)7)22(31-19)17-30-23(27)25(2,3)4/h8-11,13-14,19-22H,1,12,15-17H2,2-7H3/t19-,20+,21-,22+/m0/s1 |
| InChIKey | GCYDGHVADRUKGG-LNRXMEIDSA-N |
| XLogP | 4.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|