C23H34O8 — CID 154702130
[(2S,3S,4R,5S)-5-(2,2-dimethylpropanoyloxy)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 154702130) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-5-(2,2-dimethylpropanoyloxy)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R,5S)-5-(2,2-dimethylpropanoyloxy)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 154702130 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(2S,3S,4R,5S)-5-(2,2-dimethylpropanoyloxy)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1OC(O)[C@@H](OC(=O)C(C)(C)C)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C23H34O8/c1-22(2,3)20(26)29-13-15-16(24)17(28-12-14-10-8-7-9-11-14)18(19(25)30-15)31-21(27)23(4,5)6/h7-11,15-19,24-25H,12-13H2,1-6H3/t15-,16-,17+,18-,19?/m0/s1 |
| InChIKey | WNCMASBDQWVRHL-BMMZCLLGSA-N |
| XLogP | 2.20 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |