C34H46O9 — CID 134953671
[(2R,4R,5S,6R)-3,4-bis(2,2-dimethylpropanoyloxy)-5-hydroxy-6-(4-phenylmethoxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134953671) has the molecular formula C34H46O9 and a molecular weight of 598.73 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-3,4-bis(2,2-dimethylpropanoyloxy)-5-hydroxy-6-(4-phenylmethoxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,4R,5S,6R)-3,4-bis(2,2-dimethylpropanoyloxy)-5-hydroxy-6-(4-phenylmethoxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134953671 |
| Molecular Formula | C34H46O9 |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | [(2R,4R,5S,6R)-3,4-bis(2,2-dimethylpropanoyloxy)-5-hydroxy-6-(4-phenylmethoxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H](c2ccc(OCc3ccccc3)cc2)[C@H](O)[C@@H](OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H46O9/c1-32(2,3)29(36)40-20-24-27(42-30(37)33(4,5)6)28(43-31(38)34(7,8)9)25(35)26(41-24)22-15-17-23(18-16-22)39-19-21-13-11-10-12-14-21/h10-18,24-28,35H,19-20H2,1-9H3/t24-,25+,26-,27?,28-/m1/s1 |
| InChIKey | QYQLJUSQSYGINC-RYFPYHDGSA-N |
| XLogP | 5.57 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|