C32H47BrO9 — CID 90239755
[(2R,3R,4S,5R,6R)-6-(4-bromophenyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 90239755) has the molecular formula C32H47BrO9 and a molecular weight of 655.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-(4-bromophenyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-(4-bromophenyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90239755 |
| Molecular Formula | C32H47BrO9 |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-(4-bromophenyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H](c2ccc(Br)cc2)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H47BrO9/c1-29(2,3)25(34)38-17-20-22(40-26(35)30(4,5)6)24(42-28(37)32(10,11)12)23(41-27(36)31(7,8)9)21(39-20)18-13-15-19(33)16-14-18/h13-16,20-24H,17H2,1-12H3/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | LNHQBNQOCBJECZ-MRKXFKPJSA-N |
| XLogP | 6.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|