C26H44O9S — CID 15361654
[(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-sulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15361654) has the molecular formula C26H44O9S and a molecular weight of 532.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-sulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-sulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15361654 |
| Molecular Formula | C26H44O9S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-sulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](S)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H44O9S/c1-23(2,3)19(27)31-13-14-15(33-20(28)24(4,5)6)16(34-21(29)25(7,8)9)17(18(36)32-14)35-22(30)26(10,11)12/h14-18,36H,13H2,1-12H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | NVAWHQYOKIZJMP-SFFUCWETSA-N |
| XLogP | 4.10 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|