C31H53NO10 — CID 3989370
[6-(2,2-dimethylpropanoylamino)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 3989370) has the molecular formula C31H53NO10 and a molecular weight of 599.76 g/mol. Its IUPAC name is [6-(2,2-dimethylpropanoylamino)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [6-(2,2-dimethylpropanoylamino)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 3989370 |
| Molecular Formula | C31H53NO10 |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.37 |
| IUPAC Name | [6-(2,2-dimethylpropanoylamino)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)NC1OC(COC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H53NO10/c1-27(2,3)22(33)32-21-20(42-26(37)31(13,14)15)19(41-25(36)30(10,11)12)18(40-24(35)29(7,8)9)17(39-21)16-38-23(34)28(4,5)6/h17-21H,16H2,1-15H3,(H,32,33) |
| InChIKey | RKRAMKLHHDYVOP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|