C32H48N2O10 — CID 46374550
[3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(pyridine-2-carbonylamino)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 46374550) has the molecular formula C32H48N2O10 and a molecular weight of 620.74 g/mol. Its IUPAC name is [3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(pyridine-2-carbonylamino)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(pyridine-2-carbonylamino)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46374550 |
| Molecular Formula | C32H48N2O10 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | [3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(pyridine-2-carbonylamino)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1OC(NC(=O)c2ccccn2)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H48N2O10/c1-29(2,3)25(36)40-17-19-20(42-26(37)30(4,5)6)21(43-27(38)31(7,8)9)22(44-28(39)32(10,11)12)24(41-19)34-23(35)18-15-13-14-16-33-18/h13-16,19-22,24H,17H2,1-12H3,(H,34,35) |
| InChIKey | ICJWOFSATDARPN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|