C40H57NO9 — CID 14682928
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-naphthalen-2-ylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 14682928) has the molecular formula C40H57NO9 and a molecular weight of 695.89 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-naphthalen-2-ylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-naphthalen-2-ylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14682928 |
| Molecular Formula | C40H57NO9 |
| Molecular Weight | 695.89 g/mol |
| Exact Mass | 695.40 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-naphthalen-2-ylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](N[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C40H57NO9/c1-14-17-27(26-21-20-24-18-15-16-19-25(24)22-26)41-32-31(50-36(45)40(11,12)13)30(49-35(44)39(8,9)10)29(48-34(43)38(5,6)7)28(47-32)23-46-33(42)37(2,3)4/h14-16,18-22,27-32,41H,1,17,23H2,2-13H3/t27-,28+,29-,30-,31+,32+/m0/s1 |
| InChIKey | AYSNRAINBZAYSV-BUOONKCFSA-N |
| XLogP | 7.23 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.89 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|