C41H55ClN2O9 — CID 102486940
[(2R,3S,4S,5R,6R)-6-[[(S)-(3-chlorophenyl)-(1H-indol-3-yl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102486940) has the molecular formula C41H55ClN2O9 and a molecular weight of 755.35 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[[(S)-(3-chlorophenyl)-(1H-indol-3-yl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[[(S)-(3-chlorophenyl)-(1H-indol-3-yl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102486940 |
| Molecular Formula | C41H55ClN2O9 |
| Molecular Weight | 755.35 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(S)-(3-chlorophenyl)-(1H-indol-3-yl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N[C@@H](c2cccc(Cl)c2)c2c[nH]c3ccccc23)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C41H55ClN2O9/c1-38(2,3)34(45)49-22-28-30(51-35(46)39(4,5)6)31(52-36(47)40(7,8)9)32(53-37(48)41(10,11)12)33(50-28)44-29(23-16-15-17-24(42)20-23)26-21-43-27-19-14-13-18-25(26)27/h13-21,28-33,43-44H,22H2,1-12H3/t28-,29+,30+,31+,32-,33-/m1/s1 |
| InChIKey | WOSFWDLCSWDYSH-WPQDSKLISA-N |
| XLogP | 7.69 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.35 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|