C13H14N2O3 — CID 67232223
ethyl 3-amino-2-(1H-indol-3-yl)-3-oxopropanoate (PubChem CID 67232223) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 3-amino-2-(1H-indol-3-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-amino-2-(1H-indol-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 67232223 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethyl 3-amino-2-(1H-indol-3-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(N)=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H14N2O3/c1-2-18-13(17)11(12(14)16)9-7-15-10-6-4-3-5-8(9)10/h3-7,11,15H,2H2,1H3,(H2,14,16) |
| InChIKey | PEZQRTVIJGASEJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|