C24H25NO6 — CID 11582604
2-O-benzyl 1-O,1-O-diethyl (2R)-2-(1H-indol-3-yl)ethane-1,1,2-tricarboxylate (PubChem CID 11582604) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-O-benzyl 1-O,1-O-diethyl (2R)-2-(1H-indol-3-yl)ethane-1,1,2-tricarboxylate.
| Compound Name | 2-O-benzyl 1-O,1-O-diethyl (2R)-2-(1H-indol-3-yl)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 11582604 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-O-benzyl 1-O,1-O-diethyl (2R)-2-(1H-indol-3-yl)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C(=O)OCc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25NO6/c1-3-29-23(27)21(24(28)30-4-2)20(18-14-25-19-13-9-8-12-17(18)19)22(26)31-15-16-10-6-5-7-11-16/h5-14,20-21,25H,3-4,15H2,1-2H3/t20-/m0/s1 |
| InChIKey | GWMZWCKFYMONFA-FQEVSTJZSA-N |
| XLogP | 3.74 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|