C29H28N2O5 — CID 134106953
dibenzyl 2-acetamido-2-[1-(1H-indol-3-yl)ethyl]propanedioate (PubChem CID 134106953) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is dibenzyl 2-acetamido-2-[1-(1H-indol-3-yl)ethyl]propanedioate.
| Compound Name | dibenzyl 2-acetamido-2-[1-(1H-indol-3-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 134106953 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | dibenzyl 2-acetamido-2-[1-(1H-indol-3-yl)ethyl]propanedioate |
| SMILES | CC(=O)NC(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H28N2O5/c1-20(25-17-30-26-16-10-9-15-24(25)26)29(31-21(2)32,27(33)35-18-22-11-5-3-6-12-22)28(34)36-19-23-13-7-4-8-14-23/h3-17,20,30H,18-19H2,1-2H3,(H,31,32) |
| InChIKey | ZFDLPLQZTAOQFQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|