C21H18N2O3 — CID 71745838
benzyl N-[furan-3-yl(1H-indol-3-yl)methyl]carbamate (PubChem CID 71745838) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is benzyl N-[furan-3-yl(1H-indol-3-yl)methyl]carbamate.
| Compound Name | benzyl N-[furan-3-yl(1H-indol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 71745838 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | benzyl N-[furan-3-yl(1H-indol-3-yl)methyl]carbamate |
| SMILES | O=C(NC(c1ccoc1)c1c[nH]c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c24-21(26-13-15-6-2-1-3-7-15)23-20(16-10-11-25-14-16)18-12-22-19-9-5-4-8-17(18)19/h1-12,14,20,22H,13H2,(H,23,24) |
| InChIKey | AIYXSWHEAJLVBE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |